/*
* Redberry: symbolic tensor computations.
*
* Copyright (c) 2010-2014:
* Stanislav Poslavsky <stvlpos@mail.ru>
* Bolotin Dmitriy <bolotin.dmitriy@gmail.com>
*
* This file is part of Redberry.
*
* Redberry is free software: you can redistribute it and/or modify
* it under the terms of the GNU General Public License as published by
* the Free Software Foundation, either version 3 of the License, or
* (at your option) any later version.
*
* Redberry is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU General Public License for more details.
*
* You should have received a copy of the GNU General Public License
* along with Redberry. If not, see <http://www.gnu.org/licenses/>.
*/
package cc.redberry.core.groups.permutations;
import cc.redberry.core.combinatorics.IntTuplesPort;
import cc.redberry.core.context.CC;
import cc.redberry.core.utils.*;
import gnu.trove.set.hash.TIntHashSet;
import org.apache.commons.math3.primes.Primes;
import org.apache.commons.math3.random.RandomGenerator;
import org.apache.commons.math3.util.FastMath;
import java.math.BigInteger;
import java.util.*;
import static cc.redberry.core.groups.permutations.AlgorithmsBase.*;
import static cc.redberry.core.number.NumberUtils.factorial;
/**
* Implementation of permutation group; this class provides a number of methods for work wih permutation groups,
* including membership testing, coset enumeration, searching for centralizers, stabilizers, etc (for details see
* method summary). The instances of this class are immutable. The iterator returned by this class's {@code iterator()}
* method iterates over all elements of this group.
* <p>
* <b><big>Example</big></b>
* </p>
* <p>
* The following example gives a brief overview of the basic usage of {@code PermutationGroup}
* <br>
* <pre style="background:#f1f1f1;color:#000"><span style="color:#406040">//Construct permutation group of degree 13 with two generators (written in one-line notation)</span>
* <span style="color:#a08000">PermutationGroup</span> pg <span style="color:#2060a0">=</span> <span style="color:#a08000">PermutationGroup</span>.createPermutationGroup(
* <span style="color:#a08000"> Permutations</span><span style="color:#2060a0">.</span>createPermutation(<span style="color:#0080a0">9</span>, <span style="color:#0080a0">1</span>, <span style="color:#0080a0">2</span>, <span style="color:#0080a0">0</span>, <span style="color:#0080a0">4</span>, <span style="color:#0080a0">8</span>, <span style="color:#0080a0">5</span>, <span style="color:#0080a0">11</span>, <span style="color:#0080a0">6</span>, <span style="color:#0080a0">3</span>, <span style="color:#0080a0">10</span>, <span style="color:#0080a0">12</span>, <span style="color:#0080a0">7</span>),
* <span style="color:#a08000"> Permutations</span><span style="color:#2060a0">.</span>createPermutation(<span style="color:#0080a0">2</span>, <span style="color:#0080a0">0</span>, <span style="color:#0080a0">1</span>, <span style="color:#0080a0">8</span>, <span style="color:#0080a0">3</span>, <span style="color:#0080a0">5</span>, <span style="color:#0080a0">7</span>, <span style="color:#0080a0">11</span>, <span style="color:#0080a0">4</span>, <span style="color:#0080a0">12</span>, <span style="color:#0080a0">9</span>, <span style="color:#0080a0">6</span>, <span style="color:#0080a0">10</span>));
* <span style="color:#406040">//this group is transitive</span>
* <span style="color:#2060a0">assert</span> pg<span style="color:#2060a0">.</span>isTransitive();
* <span style="color:#406040">//its order = 5616</span>
* <span style="color:#a08000">System</span><span style="color:#2060a0">.</span>out<span style="color:#2060a0">.</span>println(pg<span style="color:#2060a0">.</span>order());
* <span style="color:#406040">//Create alternating group Alt(13)</span>
* <span style="color:#a08000">PermutationGroup</span> alt13 <span style="color:#2060a0">=</span> <span style="color:#a08000">PermutationGroup</span><span style="color:#2060a0">.</span>alternatingGroup(<span style="color:#0080a0">13</span>);
* <span style="color:#406040">//its order = 3113510400</span>
* <span style="color:#a08000">System</span><span style="color:#2060a0">.</span>out<span style="color:#2060a0">.</span>println(alt13<span style="color:#2060a0">.</span>order());
* <span style="color:#2060a0">assert</span> alt13<span style="color:#2060a0">.</span>containsSubgroup(pg);
* <span style="color:#406040">//Direct product of two groups</span>
* <span style="color:#a08000">PermutationGroup</span> pp <span style="color:#2060a0">=</span> pg<span style="color:#2060a0">.</span>directProduct(<span style="color:#a08000">PermutationGroup</span><span style="color:#2060a0">.</span>symmetricGroup(<span style="color:#0080a0">8</span>));
* <span style="color:#406040">//Setwise stabilizer</span>
* <span style="color:#a08000">PermutationGroup</span> sw <span style="color:#2060a0">=</span> pp<span style="color:#2060a0">.</span>setwiseStabilizer(<span style="color:#0080a0">1</span>, <span style="color:#0080a0">2</span>, <span style="color:#0080a0">3</span>, <span style="color:#0080a0">9</span>, <span style="color:#0080a0">10</span>, <span style="color:#0080a0">11</span>, <span style="color:#0080a0">12</span>, <span style="color:#0080a0">3</span>, <span style="color:#0080a0">14</span>, <span style="color:#0080a0">15</span>, <span style="color:#0080a0">16</span>, <span style="color:#0080a0">17</span>, <span style="color:#0080a0">18</span>);
* <span style="color:#2060a0">assert</span> pp<span style="color:#2060a0">.</span>containsSubgroup(sw);
* <span style="color:#406040">//its order = 17280</span>
* <span style="color:#a08000">System</span><span style="color:#2060a0">.</span>out<span style="color:#2060a0">.</span>println(sw<span style="color:#2060a0">.</span>order());
* <span style="color:#406040">//Center of this stabilizer</span>
* <span style="color:#a08000">PermutationGroup</span> center <span style="color:#2060a0">=</span> sw<span style="color:#2060a0">.</span>center();
* <span style="color:#406040">//it is abelian group</span>
* <span style="color:#2060a0">assert</span> center<span style="color:#2060a0">.</span>isAbelian();
* <span style="color:#406040">//generators of center</span>
* <span style="color:#a08000">System</span><span style="color:#2060a0">.</span>out<span style="color:#2060a0">.</span>println(center<span style="color:#2060a0">.</span>generators());
* <span style="color:#406040">//[+{}, +{{19, 20}}, +{{2, 10}, {3, 9}, {6, 8}, {11, 12}}]</span>
* <span style="color:#406040">//orbits of center</span>
* <span style="color:#a08000">int</span>[][] orbits <span style="color:#2060a0">=</span> center<span style="color:#2060a0">.</span>orbits();
* <span style="color:#2060a0">for</span> (<span style="color:#a08000">int</span>[] orbit <span style="color:#2060a0">:</span> orbits)
* <span style="color:#2060a0">if</span> (orbit<span style="color:#2060a0">.</span>length <span style="color:#2060a0">!=</span> <span style="color:#0080a0">1</span>)
* <span style="color:#a08000">System</span><span style="color:#2060a0">.</span>out<span style="color:#2060a0">.</span>print(<span style="color:#a08000">Arrays</span><span style="color:#2060a0">.</span>toString(orbit));
* <span style="color:#406040">//[2, 10], [3, 9], [6, 8], [11, 12], [19, 20]</span>
* </pre>
* </p>
* <p>
* <b><big>Implementation and complexity</big></b>
* </p>
* <p>
* The implementation is based on <i>base and strong generating set</i> (BSGS), which is constructed using Schreier-Sims
* algorithm ({@link cc.redberry.core.groups.permutations.AlgorithmsBase#SchreierSimsAlgorithm(java.util.ArrayList)}).
* Schreier-Sims algorithm has O(n^6 +k*n^2) complexity (where n is a degree of group), which can be crucial for
* groups with large bases. Since not all methods require BSGS, the BSGS structure of {@code PermutationGroup} is
* <i>lazy initialized</i>, i.e. its initialization occurs on the first invocation of method that uses BSGS.
* </p>
* <p>
* <b>Structural calculations.</b> Generally, all structural calculations have polynomial time complexity. The polynomial-time operations include:
* calculation of orbits (do not require BSGS); membership testing; calculation of order, base and
* strong generating set, pointwise stabilizers, union and direct product of groups; tests for
* commutativity, transitivity, Alt(n) and Sym(n) testing; calculation of normal closure and derived subgroup.
* </p>
* <p>
* <b>Backtrack search.</b> On the other hand, the algorithms that use backtrack search methods have exponential complexity in the
* worst case, which also hardly depends on the input. This algorithms include: calculation of setwise stabilizers,
* intersections of groups, coset representatives, centralizers. The exception is the calculation of center of group
* which is always polynomial.
* </p>
*
* @author Dmitry Bolotin
* @author Stanislav Poslavsky
* @see cc.redberry.core.groups.permutations.Permutation
* @see cc.redberry.core.groups.permutations.AlgorithmsBase
* @see cc.redberry.core.groups.permutations.AlgorithmsBacktrack
* @see cc.redberry.core.groups.permutations.BacktrackSearch
* @since 1.1.6
*/
public final class PermutationGroup
implements Iterable<Permutation> {
public static final PermutationGroup TRIVIAL_GROUP = new PermutationGroup();
/**
* Generators of group
*/
private final List<Permutation> generators;
/**
* Degree that used to represent Schreier vectors etc.
*/
private final int internalDegree;
/**
* Points accessory in orbits
*/
private final int[] positionsInOrbits;
/**
* Group orbits
*/
private final int[][] orbits;
/* lazy fields */
/**
* Base and strong generating set
*/
private List<BSGSElement> bsgs = null;
/**
* Cached base array
*/
private int[] base = null;
/**
* Group order
*/
private BigInteger order = null;
/**
* Ordering induced by base
*/
private InducedOrdering ordering = null;
private PermutationGroup(List<Permutation> generators, int internalDegree, int b) {
if (generators.isEmpty())
throw new IllegalArgumentException("Empty generators.");
this.generators = Collections.unmodifiableList(new ArrayList<>(generators));
this.internalDegree = internalDegree;
this.positionsInOrbits = new int[internalDegree];
this.orbits = Permutations.orbits(generators, this.positionsInOrbits);
}
private PermutationGroup(List<BSGSElement> bsgs, int internalDegree) {
if (bsgs.isEmpty())
throw new IllegalArgumentException("Empty BSGS specified.");
this.bsgs = Collections.unmodifiableList(bsgs);
this.base = getBaseAsArray(bsgs);
this.internalDegree = internalDegree;
this.order = calculateOrder(bsgs);
this.positionsInOrbits = new int[internalDegree];
this.generators = bsgs.get(0).stabilizerGenerators;
this.orbits = Permutations.orbits(bsgs.get(0).stabilizerGenerators, this.positionsInOrbits);
this.ordering = new InducedOrdering(base);
}
//trivial group
private PermutationGroup() {
this.bsgs = AlgorithmsBase.TRIVIAL_BSGS;
this.base = new int[0];
this.internalDegree = 1;
this.order = BigInteger.ONE;
this.positionsInOrbits = new int[0];
this.generators = Collections.singletonList(Permutations.getIdentityPermutation());
this.orbits = new int[0][0];
this.ordering = new InducedOrdering(base);
}
public static PermutationGroup trivialGroup() {
return TRIVIAL_GROUP;
}
/**
* Creates permutation group with a given generating set.
*
* @param generators generating set
*/
public static PermutationGroup createPermutationGroup(Permutation... generators) {
return createPermutationGroup(Arrays.asList(generators));
}
/**
* Creates permutation group with a given generating set.
*
* @param generators generating set
*/
public static PermutationGroup createPermutationGroup(List<Permutation> generators) {
int degree = Permutations.internalDegree(generators);
if (degree == 0)
return TRIVIAL_GROUP;
return new PermutationGroup(generators, degree, 0);
}
/**
* Creates permutation group with a given base and strong generating set.
*
* @param bsgs base and strong generating set
*/
public static PermutationGroup createPermutationGroupFromBSGS(List<BSGSElement> bsgs) {
int degree = bsgs.get(0).internalDegree();
if (degree == 0)
return TRIVIAL_GROUP;
return new PermutationGroup(bsgs, degree);
}
/**
* Creates symmetric group of specified degree. BSGS structure of symmetric group will be constructed in O(n^2) time.
*
* @param degree degree
* @return symmetric group of specified degree
* @see cc.redberry.core.groups.permutations.AlgorithmsBase#createSymmetricGroupBSGS(int)
*/
public static PermutationGroup symmetricGroup(int degree) {
return createPermutationGroupFromBSGS(createSymmetricGroupBSGS(degree));
}
/**
* Creates symmetric group of specified degree, where all odd permutations are antisymmetries. BSGS structure of
* symmetric group will be constructed in O(n^2) time.
*
* @param degree degree
* @return antisymmetric group of specified degree
* @see cc.redberry.core.groups.permutations.AlgorithmsBase#createSymmetricGroupBSGS(int)
*/
public static PermutationGroup antisymmetricGroup(int degree) {
return createPermutationGroupFromBSGS(createAntisymmetricGroupBSGS(degree));
}
/**
* Creates alternating group of specified degree. BSGS structure of alternating group will be constructed in O(n^2) time.
*
* @param degree degree
* @return alternating group of specified degree
* @see cc.redberry.core.groups.permutations.AlgorithmsBase#createAlternatingGroupBSGS(int)
*/
public static PermutationGroup alternatingGroup(int degree) {
return createPermutationGroupFromBSGS(createAlternatingGroupBSGS(degree));
}
/**
* Initializes lazy fields
*/
private void ensureBSGSIsInitialized() {
if (bsgs == null) {
if (base != null)
bsgs = AlgorithmsBase.createBSGSList(base, generators, internalDegree);
else
bsgs = AlgorithmsBase.createBSGSList(generators, internalDegree);
if (bsgs.isEmpty())
bsgs = TRIVIAL_BSGS;
else
bsgs = Collections.unmodifiableList(bsgs);
base = getBaseAsArray(bsgs);
order = calculateOrder(bsgs);
ordering = new InducedOrdering(base);
}
}
////////////////////// METHODS THAT NOT USE BSGS /////////////////////////
/**
* Returns positions of points in array of orbits, i.e. for each point {@code orbits()[getPositionsInOrbits()[point]]} -
* is its orbit.
*
* @return positions of points in array of orbits
*/
public int[] getPositionsInOrbits() {
return positionsInOrbits.clone();
}
/**
* Returns an unmodifiable list of group generators.
*
* @return unmodifiable list of group generators
*/
public List<Permutation> generators() {
return generators;
}
/**
* Returns the natural degree of this group, i.e. the largest point moved by this group plus one.
*
* @return the largest point moved by this group plus one
*/
public int degree() {
return internalDegree;
}
/**
* Returns the orbit of specified point.
*
* @param point point
* @return orbit of specified point
*/
public int[] orbit(int point) {
if (point >= internalDegree)
return new int[]{point};
return orbits[positionsInOrbits[point]].clone();
}
/**
* Returns size of orbit of specified point.
*
* @param point point
* @return size of orbit of specified point
*/
public int orbitSize(int point) {
if (point >= internalDegree)
return 1;
return orbits[positionsInOrbits[point]].length;
}
/**
* Returns the orbit of specified set of points.
*
* @param points set of points
* @return orbit of specified set of points
*/
public int[] orbit(int... points) {
IntArrayList orbit = new IntArrayList();
TIntHashSet orbitsIndexesSet = new TIntHashSet();
for (int i : points) {
if (i < internalDegree) {
if (!orbitsIndexesSet.contains(positionsInOrbits[i])) {
orbitsIndexesSet.ensureCapacity(orbits[positionsInOrbits[i]].length);
orbitsIndexesSet.add(positionsInOrbits[i]);
orbit.addAll(orbits[positionsInOrbits[i]]);
}
} else if (!orbitsIndexesSet.contains(i)) {
orbitsIndexesSet.add(i);
orbit.add(i);
}
}
return orbit.toArray();
}
/**
* Returns an array of all orbits.
*
* @return an array of all orbits
*/
public int[][] orbits() {
int[][] r = new int[orbits.length][];
for (int i = 0; i < orbits.length; ++i)
r[i] = orbits[i].clone();
return r;
}
/**
* Returns an index of orbit of this point in the array of all orbits returned by method {@link #orbits()},
* i.e. {@code orbits()[indexOfOrbit(point)]} is orbit of specified point, or -1 if {@code point >= degree()}.
*
* @param point point
* @return index of orbit of this point in the array of all orbits or -1 if {@code point >= degree()}
*/
public int indexOfOrbit(int point) {
if (point >= internalDegree)
return -1;
return positionsInOrbits[point];
}
/**
* Returns true if this group is transitive under the action on the set of its moved points and false otherwise.
*
* @return true if this group is transitive under the action on the set of its moved points and false otherwise
*/
public boolean isTransitive() {
if (isTrivial())
return false;
return orbits.length == 1;
}
/**
* Returns true if this group acts transitively on the array {@code [from, from + 1,...,to-1]} and false if not.
*
* @return true if this group acts transitively on the array {@code [from, from + 1,...,to-1]} and false if not
*/
public boolean isTransitive(int from, int to) {
if (from > to)
throw new IllegalArgumentException("Specified from less then specified to.");
if (to >= internalDegree)
return false;
for (int i = from + 1; i < to; ++i)
if (positionsInOrbits[i] != positionsInOrbits[i - 1])
return false;
return true;
}
Boolean isTrivial = null;
/**
* Returns true if this group is trivial and false otherwise.
*
* @return true if this group is trivial and false otherwise
*/
public boolean isTrivial() {
if (isTrivial != null)
return isTrivial.booleanValue();
isTrivial = true;
for (Permutation p : generators)
if (!p.isIdentity()) {
isTrivial = false;
break;
}
return isTrivial;
}
private Boolean isAbelian = null;
/**
* Returns true if this group is abelian and false otherwise.
*
* @return true if this group is abelian and false otherwise.
*/
public boolean isAbelian() {
if (isTrivial())
return true;
if (isAbelian != null)
return isAbelian.booleanValue();
isAbelian = true;
List<Permutation> generators = generators();
final int size = generators.size();
out:
for (int i = 0; i < size; ++i)
for (int j = i + 1; j < size; ++j)
if (!generators.get(i).commutator(generators.get(j)).isIdentity())
return isAbelian = false;
return isAbelian.booleanValue();
}
private List<Permutation> randomSource = null;
/**
* Returns a random source of permutations in this group.
*
* @return a random source of permutations in this group
* @see cc.redberry.core.groups.permutations.RandomPermutation#random(java.util.List, org.apache.commons.math3.random.RandomGenerator)
*/
public List<Permutation> randomSource() {
if (randomSource == null) {
ArrayList<Permutation> randomSource = new ArrayList<>(generators());
RandomPermutation.randomness(randomSource, 10, 20, CC.getRandomGenerator());
return this.randomSource = randomSource;
}
return randomSource;
}
/**
* Extends this group with specified generators, i.e. returns a union of this group and a group generated by
* specified generators.
*
* @param generators new generators
* @return a group generated by this and specified generators
*/
public PermutationGroup union(Permutation... generators) {
return union(Arrays.asList(generators));
}
/**
* Extends this group with specified generators, i.e. returns a union of this group and a group generated by
* specified generators.
*
* @param generators new generators
* @return a group generated by this and specified generators
*/
public PermutationGroup union(List<Permutation> generators) {
if (isTrivial())
return createPermutationGroup(generators);
if (bsgs != null)
if (membershipTest(generators))
return this;
List<Permutation> all_generators = new ArrayList<>(generators());
all_generators.addAll(generators);
PermutationGroup r = createPermutationGroup(all_generators);
r.base = base;
return r;
}
////////////////////// METHODS THAT USE BSGS /////////////////////////
/**
* Returns base and strong generating set of this group.
*
* @return base and strong generating set of this group
*/
public List<BSGSElement> getBSGS() {
ensureBSGSIsInitialized();
return bsgs;
}
/**
* Returns base of this group.
*
* @return base of this group
*/
public int[] getBase() {
ensureBSGSIsInitialized();
return base.clone();
}
/**
* Returns reference to base array.
*
* @return reference to base array
*/
private int[] base() {
ensureBSGSIsInitialized();
return base;
}
/**
* Returns the order of this group, i.e. the number of permutations in this group.
*
* @return the order of this group
*/
public BigInteger order() {
ensureBSGSIsInitialized();
return order;
}
/**
* Returns an ordering on Ω(degree) induced by a base of this group.
*
* @return ordering on Ω(degree) induced by a base of this group
*/
public InducedOrdering ordering() {
ensureBSGSIsInitialized();
return ordering;
}
/**
* Returns true if specified permutation is member of this group and false otherwise.
*
* @param permutation permutation
* @return true if specified permutation is member of this group and false otherwise
*/
public boolean membershipTest(Permutation permutation) {
if (isTrivial())
return permutation.isIdentity();
return AlgorithmsBase.membershipTest(getBSGS(), permutation);
}
/**
* Returns true if all specified permutations are members of this group and false otherwise.
*
* @param permutations permutations
* @return true if all specified permutations are members of this group and false otherwise
* @see #membershipTest(Permutation)
*/
public boolean membershipTest(Collection<Permutation> permutations) {
for (Permutation p : permutations)
if (!membershipTest(p))
return false;
return true;
}
/**
* Returns uniformly distributed random permutation from this group.
*
* @return uniformly distributed random permutation from this group
*/
public Permutation randomElement() {
return randomElement(CC.getRandomGenerator());
}
/**
* Returns uniformly distributed random permutation from this group.
*
* @param generator random generator to be used in generation of random permutation
* @return uniformly distributed random permutation from this group
*/
public Permutation randomElement(RandomGenerator generator) {
// Getting BSGS
List<BSGSElement> bsgs = getBSGS();
// Getting random transversal from first BSGS element
BSGSElement element = bsgs.get(0);
Permutation result = element.getTransversalOf(element.getOrbitPoint(generator.nextInt(element.orbitSize())));
for (int i = 1; i < bsgs.size(); ++i) {
element = bsgs.get(i);
// Multiplying result by random transversal from each BSGS element
result = result.composition(element.getTransversalOf(element.getOrbitPoint(generator.nextInt(element.orbitSize()))));
}
return result;
}
/**
* Returns a mutable copy of base and strong generating set.
*
* @return a mutable copy of base and strong generating set
*/
public ArrayList<BSGSCandidateElement> getBSGSCandidate() {
return asBSGSCandidatesList(getBSGS());
}
private Boolean isSymmetric = null;
/**
* Returns true if this group is natural symmetric group and false otherwise.
*
* @return true is this group is natural symmetric group and false otherwise
*/
public boolean isSymmetric() {
if (isSymmetric != null)
return isSymmetric;
if (isTrivial())
return isSymmetric = false;
if (isTrivial() || !isTransitive())
return isSymmetric = false;
if (internalDegree > 2 && generators().size() == 1)
return isSymmetric = false;
isSymmetric = isSymOrAlt(DEFAULT_CONFIDENCE_LEVEL);
if (isSymmetric) {
boolean containsOdd = false;
for (Permutation p : generators())
if (p.parity() == 1) {
containsOdd = true;
break;
}
return isSymmetric = containsOdd;
} else
return isSymmetric = order().equals(factorial(internalDegree));
}
private Boolean isAlternating = null;
/**
* Returns true is this group is natural alternating group Alt(degree) and false otherwise.
*
* @return true is this group is natural alternating group Alt(degree) and false otherwise
*/
public boolean isAlternating() {
if (isAlternating != null)
return isAlternating;
if (isTrivial())
return isAlternating = false;
if (isTrivial() || !isTransitive())
return isAlternating = false;
isAlternating = isSymOrAlt(DEFAULT_CONFIDENCE_LEVEL);
if (!isAlternating)
isAlternating = order().equals(factorial(internalDegree).divide(BigInteger.valueOf(2)));
if (isAlternating) {
List<Permutation> generators = generators();
for (Permutation p : generators)
if (p.parity() == 1)
return isAlternating = false;
}
return isAlternating;
}
private static double DEFAULT_CONFIDENCE_LEVEL = 1 - 1E-6;
/**
* Tests whether this is Sym or Alt (for degree > 8) using random, see Sec. 4.2 in [Holt05].
*
* @param CL confidence level
*/
private boolean isSymOrAlt(double CL) {
if (internalDegree < 8)
return false;
double c = internalDegree <= 16 ? 0.34 : 0.57;
int num = (int) (-FastMath.log(1 - CL) * FastMath.log(2, internalDegree) / c);
List<Permutation> randomSource = randomSource();
for (int i = 0; i < num; ++i) {
int[] lengths = RandomPermutation.random(randomSource).lengthsOfCycles();
for (int length : lengths)
if (length > internalDegree / 2 && length < internalDegree - 2 && Primes.isPrime(length))
return true;
}
return false;
}
/**
* Returns true if this group is regular (transitive and its order equals to degree) and false otherwise,
*
* @return true if this group is regular and false otherwise
*/
public boolean isRegular() {
return isTransitive() && order().equals(BigInteger.valueOf(internalDegree));
}
/**
* Calculates a pointwise stabilizer of specified set of points.
*
* @param set set of points
* @return pointwise stabilizer of specified set of points.
*/
public PermutationGroup pointwiseStabilizer(int... set) {
if (isTrivial())
return this;
if (set.length == 0)
return this;
set = MathUtils.getSortedDistinct(set.clone());
ArraysUtils.quickSort(set, ordering());
ArrayList<BSGSCandidateElement> bsgs = getBSGSCandidate();
AlgorithmsBase.rebase(bsgs, set);
if (bsgs.size() <= set.length)
return TRIVIAL_GROUP;
return createPermutationGroupFromBSGS(asBSGSList(bsgs.subList(set.length, bsgs.size())));
}
/**
* Calculates a group which isomorphic to a pointwise stabilizer of specified set but acts on points that are not
* stabilized, i.e. the degree of the resulting group equal to {@code this.degree() - set.length} (under the
* assumption that set contains distinct points).
*
* @param set set of points
* @return pointwise stabilizer of specified set of points that acts on points which not contained in specified set
*/
public PermutationGroup pointwiseStabilizerRestricted(int... set) {
if (isTrivial())
return this;
if (set.length == 0)
return this;
set = MathUtils.getSortedDistinct(set);
final int newDegree = internalDegree - set.length;
int[] newBase = set.clone();
ArraysUtils.quickSort(newBase, ordering());
ArrayList<BSGSCandidateElement> bsgs = getBSGSCandidate();
AlgorithmsBase.rebase(bsgs, newBase);
if (bsgs.size() <= newBase.length)
return TRIVIAL_GROUP;
int[] closure = new int[newDegree];
int[] mapping = new int[internalDegree];
Arrays.fill(mapping, -1);
int pointer = 0, counter = 0;
for (int i = 0; i < internalDegree; ++i) {
if (pointer < set.length && i == set[pointer]) {
++pointer;
continue;
} else {
closure[counter] = i;
mapping[i] = counter;
++counter;
}
}
ArrayList<BSGSCandidateElement> stab = new ArrayList<>();
for (int i = newBase.length; i < bsgs.size(); ++i) {
BSGSCandidateElement e = bsgs.get(i);
if (mapping[e.basePoint] == -1)
continue;
ArrayList<Permutation> newStabs = new ArrayList<>(e.stabilizerGenerators.size());
for (Permutation p : e.stabilizerGenerators) {
int[] perm = new int[newDegree];
for (int j = 0; j < newDegree; ++j)
perm[j] = mapping[p.newIndexOf(closure[j])];
newStabs.add(Permutations.createPermutation(p.antisymmetry(), perm));
}
stab.add(new BSGSCandidateElement(mapping[e.basePoint], newStabs, newDegree));
}
return createPermutationGroupFromBSGS(asBSGSList(stab));
}
private static final double NORMAL_CLOSURE_CONFIDENCE_LEVEL = 1 - 1E-6;
/**
* Calculates normal closure of specified subgroup. The algorithm follows NORMALCLOSURE (randomized version)
* described in Sec. 3.3.2 in [Holt05].
*
* @param subgroup subgroup of this
* @return normal closure
*/
public PermutationGroup normalClosureOf(PermutationGroup subgroup) {
if (subgroup.isTrivial())
return subgroup;
if (isAlternating() && internalDegree > 4)
return this;
if (isSymmetric() && internalDegree != 4) {
//in this case the only nontrivial normal subgroup is Alt(degree)
//check that all generators of subgroups are even:
for (Permutation p : subgroup.generators)
if (p.parity() == 1)
return this; //subgroup contains odd permutations
return alternatingGroup(internalDegree);
}
//resulting BSGS
ArrayList<BSGSCandidateElement> closure = subgroup.getBSGSCandidate();
//random source of this
List<Permutation> randomSource = randomSource();
boolean completed = false, added, globalAdded = false;
while (!completed) {
//random source of closure
ArrayList<Permutation> closureSource = new ArrayList<>(closure.get(0).stabilizerGenerators);
RandomPermutation.randomness(closureSource, 10, 10, CC.getRandomGenerator());
added = false;
for (int i = 0; i < 10; ++i) {
//adding some random conjugation
Permutation c = RandomPermutation.random(randomSource).conjugate(
RandomPermutation.random(closureSource));
if (!AlgorithmsBase.membershipTest(closure, c)) {
closure.get(0).addStabilizer(c);
added = true;
globalAdded = true;
}
}
//We use random version of Schreier-Sims; although constructed BSGS is not guaranteed to be a real BSGS,
// if some element belongs to closure, the the result of membership test will be guaranteed true (nos such
// guarantee in the case of false).
if (added)
AlgorithmsBase.RandomSchreierSimsAlgorithm(closure, NORMAL_CLOSURE_CONFIDENCE_LEVEL, CC.getRandomGenerator());
//testing closure
completed = true;
out:
for (Permutation generator : generators)
for (Permutation cGenerator : closure.get(0).stabilizerGenerators)
if (!AlgorithmsBase.membershipTest(closure, generator.conjugate(cGenerator))) {
completed = false;
break out;
}
}
//check BSGS
if (globalAdded)
AlgorithmsBase.SchreierSimsAlgorithm(closure);
return createPermutationGroupFromBSGS(asBSGSList(closure));
}
/**
* Returns a commutator of this group with specified group.
*
* @param group permutation group
* @return commutator of this and specified group
*/
public PermutationGroup commutator(PermutationGroup group) {
//commutator is normal closure of set [generators, group.generators] in <generators,group.generators>.
ArrayList<Permutation> commutator = new ArrayList<>();
Permutation c;
for (Permutation a : generators)
for (Permutation b : group.generators) {
c = a.commutator(b);
if (!c.isIdentity())
commutator.add(c);
}
if (commutator.isEmpty())
return TRIVIAL_GROUP;
return union(group).normalClosureOf(createPermutationGroup(commutator));
}
private PermutationGroup derivedSubgroup = null;
/**
* Returns a derived subgroup, i.e. commutator subgroup of this with itself.
*
* @return derived subgroup, i.e. commutator subgroup of this with itself
*/
public PermutationGroup derivedSubgroup() {
if (derivedSubgroup != null)
return derivedSubgroup;
if (isSymmetric())
return derivedSubgroup = alternatingGroup(internalDegree);
if (isAlternating() && internalDegree > 4)
return derivedSubgroup = this;
return derivedSubgroup = commutator(this);
}
/**
* Calculates a setwise stabilizer of specified set of points.
*
* @param set set of points
* @return setwise stabilizer of specified set of points.
*/
public PermutationGroup setwiseStabilizer(int... set) {
if (set.length == 0)
return this;
set = MathUtils.getSortedDistinct(set.clone());
//let's rebase such that the initial segment of base is equal to set
//so at each level l < set.length we test that g(β_l) ∈ set, and if l >= set.length, then g(β_l) !∈ set
ArraysUtils.quickSort(set, ordering());
ArrayList<BSGSCandidateElement> bsgs = getBSGSCandidate();
AlgorithmsBase.rebase(bsgs, set);
//sorting set according to natural ordering
Arrays.sort(set);
//we need to ensure that no any base point β_i with i >= set.length belongs to set (such points are redundant)
for (int i = bsgs.size() - 1; i >= set.length; --i)
if (Arrays.binarySearch(set, bsgs.get(i).basePoint) >= 0)
bsgs.remove(i);
//lets take the initial subgroup equal to pointwise stabilizer
ArrayList<BSGSCandidateElement> stabilizer
= AlgorithmsBase.clone(new ArrayList<>(bsgs.subList(set.length, bsgs.size())));
//run subgroup search
int[] newBase = getBaseAsArray(bsgs);
SetwiseStabilizerSearchTest swTest = new SetwiseStabilizerSearchTest(newBase, set);
AlgorithmsBacktrack.subgroupSearch(bsgs, stabilizer,
swTest, swTest, newBase, new InducedOrdering(newBase));
return createPermutationGroupFromBSGS(asBSGSList(stabilizer));
}
/**
* TEST function for backtrack search to find setwise stabilizer.
*/
private static class SetwiseStabilizerSearchTest
implements BacktrackSearchTestFunction, Indicator<Permutation> {
//prepared base: the initial segment of base is equal to set
final int[] base;
//prepared set: set is sorted
final int[] set;
SetwiseStabilizerSearchTest(int[] base, int[] set) {
this.base = base;
this.set = set;
}
@Override
public boolean test(Permutation permutation, int level) {
if (level < set.length) {
assert Arrays.binarySearch(set, base[level]) >= 0;
return Arrays.binarySearch(set, permutation.newIndexOf(base[level])) >= 0;
} else
return Arrays.binarySearch(set, permutation.newIndexOf(base[level])) < 0;
}
@Override
public boolean is(Permutation p) {
for (int s : set)
if (Arrays.binarySearch(set, p.newIndexOf(s)) < 0)
return false;
return true;
}
}
/**
* Returns true if specified group is a subgroup of this.
*
* @param subgroup permutation group
* @return true if specified group is a subgroup of this
*/
public boolean containsSubgroup(PermutationGroup subgroup) {
if (degree() < subgroup.degree())
return false;
if (isTrivial())
return subgroup.isTrivial();
if (isSymmetric())
return true;
if (isAlternating()) {
for (Permutation p : subgroup.generators())
if (p.parity() == 1)
return false;
return true;
}
if (subgroup.order().compareTo(order()) > 0)
return false;
return membershipTest(subgroup.generators());
}
/**
* Returns a set of left coset representatives of a given subgroup in this group (by definition, left coset of
* subgroup K have a form g*K); each representative is minimal in its coset under the ordering returned by
* {@code this.ordering()}. The number of these representatives is equals to
* {@code this.order().divide(subgroup.order())}.
*
* @param subgroup a subgroup of this group
* @return set of left coset representatives
* @see cc.redberry.core.groups.permutations.AlgorithmsBacktrack#leftCosetRepresentatives(java.util.List, java.util.List)
*/
public Permutation[] leftCosetRepresentatives(PermutationGroup subgroup) {
if (isTrivial())
return new Permutation[]{Permutations.getIdentityPermutation()};
//todo implement special cases for Alt and Sym
return AlgorithmsBacktrack.leftCosetRepresentatives(getBSGS(), subgroup.getBSGS(), base(), ordering());
}
/**
* Returns a set of right coset representatives of a given subgroup in this group (by definition, right coset of
* subgroup K have a form K*g). The number of these representatives is equals to
* {@code this.order().divide(subgroup.order())}. This method calculates left coset representatives
* using {@link #leftCosetRepresentatives(PermutationGroup)} and inverse each representative. In contrast to
* {@link #leftCosetRepresentatives(PermutationGroup)} each right coset representative is not necessary minimal in
* its coset.
*
* @param subgroup a subgroup of this group
* @return set of right coset representatives
* @see #leftCosetRepresentatives(PermutationGroup)
*/
public Permutation[] rightCosetRepresentatives(PermutationGroup subgroup) {
final Permutation[] reps = leftCosetRepresentatives(subgroup);
for (int i = 0; i < reps.length; ++i)
reps[i] = reps[i].inverse();
return reps;
}
/**
* Returns a unique left coset representative of specified element; the returned representative will be
* minimal in its coset under the ordering returned by {@code ordering()}.
*
* @param subgroup a subgroup of this group
* @param element some element of this group
* @see cc.redberry.core.groups.permutations.AlgorithmsBacktrack#leftTransversalOf(Permutation, java.util.List, java.util.List)
*/
public Permutation leftTransversalOf(PermutationGroup subgroup, Permutation element) {
return AlgorithmsBacktrack.leftTransversalOf(element, getBSGS(), subgroup.getBSGS(), base(), ordering());
}
/**
* Returns a union of this and specified group, i.e. group which is generated by union of generators of this and
* specified group.
*
* @param group permutation group
* @return union of this and specified group
*/
public PermutationGroup union(PermutationGroup group) {
if (this == group)
return this;
if (isTrivial())
return group;
if (group.isTrivial())
return this;
if (bsgs == null && group.bsgs != null)
return group.union(generators());
if (group.bsgs == null)
return union(group.generators());
if (containsSubgroup(group))
return this;
if (group.containsSubgroup(this))
return group;
int[] thisBase = getBase(), othBase = group.getBase();
Arrays.sort(thisBase);
Arrays.sort(othBase);
int[] base = MathUtils.intSetUnion(thisBase, othBase);
//new generators
ArrayList<Permutation> generators = new ArrayList<>(
generators().size() + group.generators().size());
generators.addAll(generators());
generators.addAll(group.generators());
PermutationGroup r = createPermutationGroup(generators);
r.base = base;
return r;
}
/**
* Returns an intersection of this group with specified group.
*
* @param oth permutation group
* @return intersections of groups
*/
public PermutationGroup intersection(PermutationGroup oth) {
if (isTrivial())
return this;
if (oth.isTrivial())
return oth;
ArrayList<BSGSCandidateElement> intersection = new ArrayList<>();
AlgorithmsBacktrack.intersection(getBSGS(), oth.getBSGS(), intersection);
return createPermutationGroupFromBSGS(asBSGSList(intersection));
}
/**
* Returns direct product of this group and specified group. This product is organized as follows:
* the initial segment of each permutation is equal to permutation taken from this, while the rest is taken from
* specified group.
*
* @param group another group
* @return direct product this × other
*/
public PermutationGroup directProduct(PermutationGroup group) {
//todo consider all cases (bsgs calculated or not)
return createPermutationGroupFromBSGS(AlgorithmsBase.directProduct(getBSGS(), group.getBSGS()));
}
/**
* Returns some permutation that maps point <i>from</i> onto point <i>to</i> or {@code null} if no such permutation exists.
*
* @param from from point
* @param to to point
* @return some permutation that maps point <i>from</i> onto point <i>to</i> or {@code null} if no such permutation exists
*/
public Permutation mapping(int from, int to) {
if (positionsInOrbits[from] != positionsInOrbits[to])
return null;
List<BSGSElement> bsgs = getBSGS();
if (bsgs.get(0).basePoint == from)
return bsgs.get(0).getTransversalOf(to);
for (int i = 0, size = bsgs.size(); i < size; ++i)
if (bsgs.get(i).basePoint == from && bsgs.get(i).belongsToOrbit(to))
return bsgs.get(i).getTransversalOf(to);
ArrayList<BSGSCandidateElement> bsgs_c = asBSGSCandidatesList(bsgs);
AlgorithmsBase.changeBasePointWithTranspositions(bsgs_c, 0, from);
return bsgs_c.get(0).getTransversalOf(to);
}
/**
* Returns an output port of permutations that preserves specified mapping between points. To be precise: for each
* permutation <i>p</i> returned by {@link cc.redberry.core.groups.permutations.BacktrackSearch#take()} and for
* all <i>i</i> ∈ {@code {0..from.length}}, it is guaranteed to be {@code p.newIndexOf(from[i]) == to[i]}.
* <p><b>Example:</b></p>
* The following code
* <br>
* <pre style="background:#f1f1f1;color:#000"><span style="color:#a08000">Permutation</span> perm1 <span style="color:#2060a0">=</span> <span style="color:#a08000">Permutations</span><span style="color:#2060a0">.</span>createPermutation(<span style="color:#0080a0">8</span>, <span style="color:#2060a0">new</span> <span style="color:#a08000">int</span>[][]{{<span style="color:#0080a0">1</span>, <span style="color:#0080a0">2</span>, <span style="color:#0080a0">3</span>}});
* <span style="color:#a08000">Permutation</span> perm2 <span style="color:#2060a0">=</span> <span style="color:#a08000">Permutations</span><span style="color:#2060a0">.</span>createPermutation(<span style="color:#0080a0">8</span>, <span style="color:#2060a0">new</span> <span style="color:#a08000">int</span>[][]{{<span style="color:#0080a0">3</span>, <span style="color:#0080a0">4</span>, <span style="color:#0080a0">5</span>, <span style="color:#0080a0">6</span>, <span style="color:#0080a0">7</span>}});
* <span style="color:#a08000">PermutationGroup</span> pg <span style="color:#2060a0">=</span> <span style="color:#a08000">PermutationGroup</span><span style="color:#2060a0">.</span>createPermutationGroup(perm1, perm2);
* <span style="color:#a08000">BacktrackSearch</span> mappings <span style="color:#2060a0">=</span> pg<span style="color:#2060a0">.</span>mapping(<span style="color:#2060a0">new</span> <span style="color:#a08000">int</span>[]{<span style="color:#0080a0">7</span>, <span style="color:#0080a0">2</span>, <span style="color:#0080a0">1</span>, <span style="color:#0080a0">3</span>}, <span style="color:#2060a0">new</span> <span style="color:#a08000">int</span>[]{<span style="color:#0080a0">5</span>, <span style="color:#0080a0">3</span>, <span style="color:#0080a0">6</span>, <span style="color:#0080a0">1</span>});
* <span style="color:#a08000">Permutation</span> perm;
* <span style="color:#2060a0">while</span> ((perm <span style="color:#2060a0">=</span> mappings<span style="color:#2060a0">.</span>take()) <span style="color:#2060a0">!=</span> null)
* <span style="color:#a08000">System</span><span style="color:#2060a0">.</span>out<span style="color:#2060a0">.</span>println(perm);
* </pre>
* will produce 3 permutations (in cycles notation):
* <br>
* +{{1, 6, 2, 3}, {5, 7}}
* <br>
* +{{1, 6, 7, 5, 4, 2, 3}}
* <br>
* +{{1, 6, 4, 7, 5, 2, 3}}
*
* @param from points <i>from</i>
* @param to points <i>to</i>
* @return output port of permutations that preserves specified mapping between points
* @throws IllegalArgumentException if {@code from.length != to.length}
*/
public BacktrackSearch mapping(final int[] from, final int[] to) {
if (from.length != to.length)
throw new IllegalArgumentException("Length of from is not equal to length of to.");
//for (int i = 0; i < from.length; ++i)
// if (positionsInOrbits[from[i]] != positionsInOrbits[to[i]])
// return EMPTY;
final int[] _from_ = from.clone(), _to_ = to.clone();
//make rebase as simple as possible
ArraysUtils.quickSort(_from_, _to_, ordering());
ArrayList<BSGSCandidateElement> bsgs = getBSGSCandidate();
int newDegree = Math.max(internalDegree, Math.max(ArraysUtils.max(from) + 1, ArraysUtils.max(to) + 1));
AlgorithmsBacktrack.rebaseWithRedundancy(bsgs, _from_, internalDegree);
SearchForMapping mapping = new SearchForMapping(_from_, _to_);
return new BacktrackSearch(bsgs, mapping, mapping);
}
private static final class SearchForMapping
implements BacktrackSearchTestFunction, Indicator<Permutation> {
final int[] from, to;
private SearchForMapping(int[] from, int[] to) {
this.from = from;
this.to = to;
}
@Override
public boolean test(Permutation permutation, int level) {
if (level < from.length)
return permutation.newIndexOf(from[level]) == to[level];
return true;
}
@Override
public boolean is(Permutation object) {
return true;
}
}
/**
* Returns an iterator over all elements in this group.
*
* @return iterator over all elements in this group
*/
@Override
public Iterator<Permutation> iterator() {
ensureBSGSIsInitialized();
if (internalDegree == 1)
return new SingleIterator<>(Permutations.getIdentityPermutation());
return new PermIterator(); //new OutputPort.PortIterator<>(new BacktrackSearch(bsgs));
}
/**
* An iterator over all permutations in group
*/
private final class PermIterator implements Iterator<Permutation> {
private final IntTuplesPort tuplesPort;
int[] tuple;
public PermIterator() {
final int[] orbitSizes = new int[base.length];
for (int i = 0; i < orbitSizes.length; ++i)
orbitSizes[i] = bsgs.get(i).orbitSize();
tuplesPort = new IntTuplesPort(orbitSizes);
tuple = tuplesPort.take();
}
@Override
public boolean hasNext() {
return tuple != null;
}
@Override
public Permutation next() {
Permutation p = bsgs.get(0).getInverseTransversalOf(bsgs.get(0).getOrbitPoint(tuple[0]));
BSGSElement e;
for (int i = 1, size = bsgs.size(); i < size; ++i) {
e = bsgs.get(i);
p = p.composition(e.getInverseTransversalOf(e.getOrbitPoint(tuple[i])));
}
tuple = tuplesPort.take();
return p;
}
@Override
public void remove() {
throw new UnsupportedOperationException("Illegal operation.");
}
}
/**
* Computes centralizer of specified permutation.
*
* @param permutation permutation
* @return centralizer of specified element
*/
public PermutationGroup centralizerOf(final Permutation permutation) {
return centralizerOf(createPermutationGroup(permutation));
}
/**
* Computes centralizer of specified subgroup.
*
* @param subgroup a subgroup of this
* @return centralizer of specified subgroup
*/
public PermutationGroup centralizerOf(final PermutationGroup subgroup) {
if (subgroup.isAbelian() && subgroup.isTransitive(0, internalDegree))
return subgroup;
//todo special case for Sym(n)
int[] base = getBase();
if (subgroup.orbits.length != 1) {
//find for a better base
final IntComparator comparator = new IntComparator() {
@Override
public int compare(int a, int b) {
return -Integer.compare(subgroup.orbitSize(a), subgroup.orbitSize(b));
}
};
ArraysUtils.quickSort(base, comparator);
}
final ArrayList<BSGSCandidateElement> group_bsgs = getBSGSCandidate();
AlgorithmsBase.rebase(group_bsgs, base);
final ArrayList<BSGSCandidateElement> subgroup_bsgs = subgroup.getBSGSCandidate();
AlgorithmsBacktrack.rebaseWithRedundancy(subgroup_bsgs, base, internalDegree);
final Permutation[] mappings = new Permutation[base.length - 1];
for (int i = 1; i < base.length; ++i)
if (base[i] < subgroup.internalDegree && subgroup.indexOfOrbit(base[i]) == subgroup.indexOfOrbit(base[i - 1]))
mappings[i - 1] = subgroup.mapping(base[i - 1], base[i]);
CentralizerSearchTest centralizerSearch = new CentralizerSearchTest(group_bsgs, subgroup, base, mappings);
ArrayList<BSGSCandidateElement> centralizer;
if (subgroup.generators().size() == 1)
centralizer = AlgorithmsBase.clone(subgroup_bsgs);
else
centralizer = new ArrayList<>();
AlgorithmsBacktrack.subgroupSearch(group_bsgs, centralizer, centralizerSearch, centralizerSearch);
return createPermutationGroupFromBSGS(asBSGSList(centralizer));
}
/**
* Backtrack search TEST for centralizer.
*/
private static final class CentralizerSearchTest
implements BacktrackSearchTestFunction, Indicator<Permutation> {
final List<? extends BSGSElement> group_bsgs;
final PermutationGroup subgroup;
final Permutation[] mappings;
final int[] group_base;
private CentralizerSearchTest(List<? extends BSGSElement> group_bsgs,
PermutationGroup subgroup,
int[] group_base,
Permutation[] mappings) {
this.group_bsgs = group_bsgs;
this.subgroup = subgroup;
this.group_base = group_base;
this.mappings = mappings;
}
@Override
public boolean test(Permutation permutation, int level) {
if (level == 0)
return true;
//find previous base point that lies in same orbit of subgroup
if (subgroup.internalDegree < group_base[level - 1])
if (group_base[level - 1] != group_base[level])
return true;
if (subgroup.indexOfOrbit(group_base[level - 1]) != subgroup.indexOfOrbit(group_base[level]))
return true;
Permutation mapping = mappings[level - 1];
int expected = mapping.newIndexOf(permutation.newIndexOf(group_base[level - 1]));
return permutation.newIndexOf(group_base[level]) == expected;
}
@Override
public boolean is(Permutation permutation) {
if (permutation.isIdentity())
return false;
for (Permutation p : subgroup.generators())
if (!p.commutator(permutation).isIdentity())
return false;
return true;
}
}
/**
* Lazy center
*/
private PermutationGroup center = null;
/**
* Computes center of this group.
*
* @return center of this group
*/
public PermutationGroup center() {
if (center == null) {
if (isSymmetric() && internalDegree >= 3)
return center = createPermutationGroup(generators().get(0).getIdentity());
if (isAlternating() && internalDegree >= 4)
return center = createPermutationGroup(generators().get(0).getIdentity());
return center = centralizerOf(this);
}
return center;
}
/**
* Returns the conjugate permutation group of {@code this} with the specified permutation (this ^ permutation).
*
* @param permutation some permutation
* @return conjugate permutation group of {@code this} with the specified permutation
*/
public PermutationGroup conjugate(Permutation permutation) {
if (this.isTrivial())
return this;
if (bsgs == null) {
ArrayList<Permutation> newGens = new ArrayList<>(generators().size());
for (Permutation p : generators())
newGens.add(permutation.conjugate(p));
return createPermutationGroup(newGens);
} else {
List<BSGSElement> bsgs = getBSGS();
ArrayList<BSGSElement> new_bsgs = new ArrayList<>(bsgs.size());
for (BSGSElement e : bsgs) {
ArrayList<Permutation> newStabs = new ArrayList<>(e.stabilizerGenerators.size());
for (Permutation p : e.stabilizerGenerators)
newStabs.add(permutation.conjugate(p));
new_bsgs.add(new BSGSCandidateElement(permutation.newIndexOf(e.basePoint), newStabs, internalDegree).asBSGSElement());
}
return createPermutationGroupFromBSGS(new_bsgs);
}
}
/**
* Returns true if specified group is equals to this group, i.e. it is isomorphic and acts same on the Ω(degree).
*
* @param obj permutation group
* @return true if specified group has the same order and all its generators are contained in this group
*/
public boolean equals(Object obj) {
if (obj == null)
return false;
if (obj.getClass() != this.getClass())
return false;
PermutationGroup oth = (PermutationGroup) obj;
if (internalDegree != oth.internalDegree)
return false;
//todo add orbits equals!
if (orbits.length != oth.orbits.length)
return false;
//todo add orbits equals!
//if (!Arrays.deepEquals(orbits, oth.orbits))
// return false;
if (!order().equals(oth.order()))
return false;
if (generators().size() < oth.generators().size())
return oth.membershipTest(generators());
else
return membershipTest(oth.generators());
}
@Override
public String toString() {
StringBuilder sb = new StringBuilder();
sb.append("Group( ");
List<Permutation> gens = generators();
for (int i = 0; ; ++i) {
sb.append(gens.get(i));
if (i == gens.size() - 1)
return sb.append(" )").toString();
sb.append(", ");
}
}
}