/*
* Copyright 2010 Red Hat, Inc.
* Red Hat licenses this file to you under the Apache License, version
* 2.0 (the "License"); you may not use this file except in compliance
* with the License. You may obtain a copy of the License at
* http://www.apache.org/licenses/LICENSE-2.0
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
* implied. See the License for the specific language governing
* permissions and limitations under the License.
*/
package org.hornetq.core.paging.cursor.impl;
import java.lang.ref.WeakReference;
import java.util.ArrayList;
import java.util.Collections;
import java.util.HashMap;
import java.util.LinkedHashSet;
import java.util.LinkedList;
import java.util.List;
import java.util.Map;
import java.util.Map.Entry;
import java.util.Set;
import java.util.SortedMap;
import java.util.TreeMap;
import java.util.concurrent.ConcurrentLinkedQueue;
import java.util.concurrent.Executor;
import java.util.concurrent.atomic.AtomicInteger;
import java.util.concurrent.atomic.AtomicLong;
import org.hornetq.core.filter.Filter;
import org.hornetq.core.journal.IOAsyncTask;
import org.hornetq.core.logging.Logger;
import org.hornetq.core.paging.PageTransactionInfo;
import org.hornetq.core.paging.PagedMessage;
import org.hornetq.core.paging.PagingStore;
import org.hornetq.core.paging.cursor.PageCache;
import org.hornetq.core.paging.cursor.PageCursorProvider;
import org.hornetq.core.paging.cursor.PagePosition;
import org.hornetq.core.paging.cursor.PageSubscription;
import org.hornetq.core.paging.cursor.PageSubscriptionCounter;
import org.hornetq.core.paging.cursor.PagedReference;
import org.hornetq.core.persistence.StorageManager;
import org.hornetq.core.server.MessageReference;
import org.hornetq.core.server.Queue;
import org.hornetq.core.server.ServerMessage;
import org.hornetq.core.transaction.Transaction;
import org.hornetq.core.transaction.TransactionOperationAbstract;
import org.hornetq.core.transaction.TransactionPropertyIndexes;
import org.hornetq.core.transaction.impl.TransactionImpl;
import org.hornetq.utils.ConcurrentHashSet;
import org.hornetq.utils.Future;
import org.hornetq.utils.LinkedListIterator;
/**
* A PageCursorImpl
*
* A page cursor will always store its
* @author <a href="mailto:clebert.suconic@jboss.com">Clebert Suconic</a>
*
*
*/
public class PageSubscriptionImpl implements PageSubscription
{
// Constants -----------------------------------------------------
private static final Logger log = Logger.getLogger(PageSubscriptionImpl.class);
// Attributes ----------------------------------------------------
private final boolean isTrace = PageSubscriptionImpl.log.isTraceEnabled();
private static void trace(final String message)
{
PageSubscriptionImpl.log.trace(message);
}
private volatile boolean autoCleanup = true;
private final StorageManager store;
private final long cursorId;
private Queue queue;
private final boolean persistent;
private final Filter filter;
private final PagingStore pageStore;
private final PageCursorProvider cursorProvider;
private volatile PagePosition lastAckedPosition;
private List<PagePosition> recoveredACK;
private final SortedMap<Long, PageCursorInfo> consumedPages = Collections.synchronizedSortedMap(new TreeMap<Long, PageCursorInfo>());
private final PageSubscriptionCounter counter;
private final Executor executor;
private final AtomicLong deliveredCount = new AtomicLong(0);
// We only store the position for redeliveries. They will be read from the SoftCache again during delivery.
private final ConcurrentLinkedQueue<PagePosition> redeliveries = new ConcurrentLinkedQueue<PagePosition>();
// Static --------------------------------------------------------
// Constructors --------------------------------------------------
public PageSubscriptionImpl(final PageCursorProvider cursorProvider,
final PagingStore pageStore,
final StorageManager store,
final Executor executor,
final Filter filter,
final long cursorId,
final boolean persistent)
{
this.pageStore = pageStore;
this.store = store;
this.cursorProvider = cursorProvider;
this.cursorId = cursorId;
this.executor = executor;
this.filter = filter;
this.persistent = persistent;
this.counter = new PageSubscriptionCounterImpl(store, this, executor, persistent, cursorId);
}
// Public --------------------------------------------------------
public PagingStore getPagingStore()
{
return pageStore;
}
public Queue getQueue()
{
return queue;
}
public boolean isPaging()
{
return pageStore.isPaging();
}
public void setQueue(Queue queue)
{
this.queue = queue;
}
public void disableAutoCleanup()
{
autoCleanup = false;
}
public void enableAutoCleanup()
{
autoCleanup = true;
}
public PageCursorProvider getProvider()
{
return cursorProvider;
}
public void bookmark(PagePosition position) throws Exception
{
PageCursorInfo cursorInfo = getPageInfo(position);
if (position.getMessageNr() > 0)
{
cursorInfo.confirmed.addAndGet(position.getMessageNr());
}
confirmPosition(position);
}
public long getMessageCount()
{
return counter.getValue() - deliveredCount.get();
}
public PageSubscriptionCounter getCounter()
{
return counter;
}
public void scheduleCleanupCheck()
{
if (autoCleanup)
{
executor.execute(new Runnable()
{
public void run()
{
try
{
cleanupEntries();
}
catch (Exception e)
{
PageSubscriptionImpl.log.warn("Error on cleaning up cursor pages", e);
}
}
});
}
}
/**
* It will cleanup all the records for completed pages
* */
public void cleanupEntries() throws Exception
{
Transaction tx = new TransactionImpl(store);
boolean persist = false;
final ArrayList<PageCursorInfo> completedPages = new ArrayList<PageCursorInfo>();
// First get the completed pages using a lock
synchronized (this)
{
for (Entry<Long, PageCursorInfo> entry : consumedPages.entrySet())
{
PageCursorInfo info = entry.getValue();
if (info.isDone() && !info.isPendingDelete() && lastAckedPosition != null)
{
if (entry.getKey() == lastAckedPosition.getPageNr())
{
PageSubscriptionImpl.trace("We can't clear page " + entry.getKey() +
" now since it's the current page");
}
else
{
info.setPendingDelete();
completedPages.add(entry.getValue());
}
}
}
}
for (int i = 0; i < completedPages.size(); i++)
{
PageCursorInfo info = completedPages.get(i);
for (PagePosition pos : info.acks)
{
if (pos.getRecordID() > 0)
{
store.deleteCursorAcknowledgeTransactional(tx.getID(), pos.getRecordID());
if (!persist)
{
// only need to set it once
tx.setContainsPersistent();
persist = true;
}
}
}
}
tx.addOperation(new TransactionOperationAbstract()
{
@Override
public void afterCommit(final Transaction tx)
{
executor.execute(new Runnable()
{
public void run()
{
synchronized (PageSubscriptionImpl.this)
{
for (PageCursorInfo completePage : completedPages)
{
if (isTrace)
{
PageSubscriptionImpl.trace("Removing page " + completePage.getPageId());
}
if (consumedPages.remove(completePage.getPageId()) == null)
{
PageSubscriptionImpl.log.warn("Couldn't remove page " + completePage.getPageId() +
" from consumed pages on cursor for address " +
pageStore.getAddress());
}
}
}
cursorProvider.scheduleCleanup();
}
});
}
});
tx.commit();
}
/* (non-Javadoc)
* @see java.lang.Object#toString()
*/
@Override
public String toString()
{
return "PageSubscriptionImpl [cursorId=" + cursorId + ", queue=" + queue + ", filter = " + filter + "]";
}
private PagedReference getReference(PagePosition pos) throws Exception
{
return cursorProvider.newReference(pos, cursorProvider.getMessage(pos), this);
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#iterator()
*/
public LinkedListIterator<PagedReference> iterator()
{
return new CursorIterator();
}
private PagedReference internalGetNext(final PagePosition pos)
{
PagePosition retPos = pos.nextMessage();
PageCache cache = cursorProvider.getPageCache(pos);
if (cache == null || (!cache.isLive() && retPos.getMessageNr() >= cache.getNumberOfMessages()))
{
retPos = pos.nextPage();
cache = cursorProvider.getPageCache(retPos);
if (cache == null)
{
return null;
}
if (retPos.getMessageNr() >= cache.getNumberOfMessages())
{
return null;
}
}
PagedMessage serverMessage = cache.getMessage(retPos.getMessageNr());
if (serverMessage != null)
{
return cursorProvider.newReference(retPos, serverMessage, this);
}
else
{
return null;
}
}
private boolean routed(PagedMessage message)
{
long id = getId();
for (long qid : message.getQueueIDs())
{
if (qid == id)
{
return true;
}
}
return false;
}
/**
*
*/
private synchronized PagePosition getStartPosition()
{
// Get the first page not marked for deletion
// It's important to verify if it's not marked for deletion as you may have a pending request on the queue
for (Map.Entry<Long, PageCursorInfo> entry : consumedPages.entrySet())
{
if (!entry.getValue().isPendingDelete())
{
if (entry.getValue().acks.isEmpty())
{
return new PagePositionImpl(entry.getKey(), -1);
}
else
{
// The list is not ordered...
// This is only done at creation of the queue, so we just scan instead of keeping the list ordened
PagePosition retValue = null;
for (PagePosition pos : entry.getValue().acks)
{
if (isTrace)
{
trace("Analizing " + pos);
}
if (retValue == null || retValue.getMessageNr() > pos.getMessageNr())
{
retValue = pos;
}
}
if (isTrace)
{
trace("Returning initial position " + retValue);
}
return retValue;
}
}
}
return new PagePositionImpl(pageStore.getFirstPage(), -1);
}
public void confirmPosition(final Transaction tx, final PagePosition position) throws Exception
{
// if the cursor is persistent
if (persistent)
{
store.storeCursorAcknowledgeTransactional(tx.getID(), cursorId, position);
}
installTXCallback(tx, position);
}
public void ackTx(final Transaction tx, final PagedReference reference) throws Exception
{
confirmPosition(tx, reference.getPosition());
counter.increment(tx, -1);
PageTransactionInfo txInfo = getPageTransaction(reference);
if (txInfo != null)
{
txInfo.storeUpdate(store, pageStore.getPagingManager(), tx);
}
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#confirm(org.hornetq.core.paging.cursor.PagePosition)
*/
public void ack(final PagedReference reference) throws Exception
{
// Need to do the ACK and counter atomically (inside a TX) or the counter could get out of sync
Transaction tx = new TransactionImpl(this.store);
ackTx(tx, reference);
tx.commit();
}
public void confirmPosition(final PagePosition position) throws Exception
{
// if we are dealing with a persistent cursor
if (persistent)
{
store.storeCursorAcknowledge(cursorId, position);
}
store.afterCompleteOperations(new IOAsyncTask()
{
public void onError(final int errorCode, final String errorMessage)
{
}
public void done()
{
processACK(position);
}
});
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#getFirstPage()
*/
public long getFirstPage()
{
if (consumedPages.isEmpty())
{
return 0;
}
else
{
return consumedPages.firstKey();
}
}
public void addPendingDelivery(final PagePosition position)
{
getPageInfo(position).incrementPendingTX();
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#returnElement(org.hornetq.core.paging.cursor.PagePosition)
*/
public void redeliver(final PagePosition position)
{
synchronized (redeliveries)
{
redeliveries.add(position);
PageCursorInfo pageInfo = consumedPages.get(position.getPageNr());
if (pageInfo != null)
{
pageInfo.decrementPendingTX();
}
else
{
// this shouldn't really happen.
}
}
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageSubscription#queryMessage(org.hornetq.core.paging.cursor.PagePosition)
*/
public PagedMessage queryMessage(PagePosition pos)
{
try
{
return cursorProvider.getMessage(pos);
}
catch (Exception e)
{
throw new RuntimeException(e.getMessage(), e);
}
}
/**
* Theres no need to synchronize this method as it's only called from journal load on startup
*/
public void reloadACK(final PagePosition position)
{
if (recoveredACK == null)
{
recoveredACK = new LinkedList<PagePosition>();
}
recoveredACK.add(position);
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#recoverPreparedACK(org.hornetq.core.paging.cursor.PagePosition)
*/
public void reloadPreparedACK(final Transaction tx, final PagePosition position)
{
deliveredCount.incrementAndGet();
installTXCallback(tx, position);
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#positionIgnored(org.hornetq.core.paging.cursor.PagePosition)
*/
public void positionIgnored(final PagePosition position)
{
processACK(position);
}
public void lateDeliveryRollback(PagePosition position)
{
PageCursorInfo cursorInfo = processACK(position);
cursorInfo.decrementPendingTX();
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#isComplete(long)
*/
public boolean isComplete(long page)
{
PageCursorInfo info = consumedPages.get(page);
return info != null && info.isDone();
}
/**
* All the data associated with the cursor should go away here
*/
public void close() throws Exception
{
final long tx = store.generateUniqueID();
try
{
boolean isPersistent = false;
synchronized (PageSubscriptionImpl.this)
{
for (PageCursorInfo cursor : consumedPages.values())
{
for (PagePosition info : cursor.acks)
{
if (info.getRecordID() != 0)
{
isPersistent = true;
store.deleteCursorAcknowledgeTransactional(tx, info.getRecordID());
}
}
}
}
if (isPersistent)
{
store.commit(tx);
}
cursorProvider.close(this);
}
catch (Exception e)
{
try
{
store.rollback(tx);
}
catch (Exception ignored)
{
// exception of the exception.. nothing that can be done here
}
}
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#getId()
*/
public long getId()
{
return cursorId;
}
public boolean isPersistent()
{
return persistent;
}
public void processReload() throws Exception
{
if (recoveredACK != null)
{
if (isTrace)
{
PageSubscriptionImpl.trace("********** processing reload!!!!!!!");
}
Collections.sort(recoveredACK);
boolean first = true;
long txDeleteCursorOnReload = -1;
for (PagePosition pos : recoveredACK)
{
lastAckedPosition = pos;
PageCursorInfo pageInfo = getPageInfo(pos);
if (pageInfo == null)
{
log.warn("Couldn't find page cache for page " + pos + ", removing it from the journal");
if (txDeleteCursorOnReload == -1)
{
txDeleteCursorOnReload = store.generateUniqueID();
}
store.deleteCursorAcknowledgeTransactional(txDeleteCursorOnReload, pos.getRecordID());
}
else
{
if (first)
{
first = false;
if (pos.getMessageNr() > 0)
{
pageInfo.confirmed.addAndGet(pos.getMessageNr());
}
}
pageInfo.addACK(pos);
}
}
if (txDeleteCursorOnReload >= 0)
{
store.commit(txDeleteCursorOnReload);
}
recoveredACK.clear();
recoveredACK = null;
}
}
public void flushExecutors()
{
Future future = new Future();
executor.execute(future);
while (!future.await(1000))
{
PageSubscriptionImpl.log.warn("Waiting page cursor to finish executors - " + this);
}
}
public void stop()
{
flushExecutors();
}
public void printDebug()
{
printDebug(toString());
}
public void printDebug(final String msg)
{
System.out.println("Debug information on PageCurorImpl- " + msg);
for (PageCursorInfo info : consumedPages.values())
{
System.out.println(info);
}
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageSubscription#executeWithContext(java.lang.Runnable)
*/
public Executor getExecutor()
{
return executor;
}
private synchronized PageCursorInfo getPageInfo(final PagePosition pos)
{
return getPageInfo(pos, true);
}
/**
* @param page
* @return
*/
private synchronized PageCursorInfo getPageInfo(final PagePosition pos, boolean create)
{
PageCursorInfo pageInfo = consumedPages.get(pos.getPageNr());
if (create && pageInfo == null)
{
PageCache cache = cursorProvider.getPageCache(pos);
if (cache == null)
{
return null;
}
pageInfo = new PageCursorInfo(pos.getPageNr(), cache.getNumberOfMessages(), cache);
consumedPages.put(pos.getPageNr(), pageInfo);
}
return pageInfo;
}
// Package protected ---------------------------------------------
// Protected -----------------------------------------------------
protected boolean match(final ServerMessage message)
{
if (filter == null)
{
return true;
}
else
{
return filter.match(message);
}
}
// Private -------------------------------------------------------
// To be called only after the ACK has been processed and guaranteed to be on storae
// The only exception is on non storage events such as not matching messages
private PageCursorInfo processACK(final PagePosition pos)
{
if (lastAckedPosition == null || pos.compareTo(lastAckedPosition) > 0)
{
if (isTrace)
{
log.trace("a new position is being processed as ACK");
}
if (lastAckedPosition != null && lastAckedPosition.getPageNr() != pos.getPageNr())
{
if (isTrace)
{
log.trace("Scheduling cleanup on pageSubscription for address = " + pageStore.getAddress() + " queue = " + this.getQueue().getName());
}
// there's a different page being acked, we will do the check right away
if (autoCleanup)
{
scheduleCleanupCheck();
}
}
lastAckedPosition = pos;
}
PageCursorInfo info = getPageInfo(pos);
info.addACK(pos);
return info;
}
/**
* @param tx
* @param position
*/
private void installTXCallback(final Transaction tx, final PagePosition position)
{
if (position.getRecordID() > 0)
{
// It needs to persist, otherwise the cursor will return to the fist page position
tx.setContainsPersistent();
}
getPageInfo(position).remove(position);
PageCursorTX cursorTX = (PageCursorTX)tx.getProperty(TransactionPropertyIndexes.PAGE_CURSOR_POSITIONS);
if (cursorTX == null)
{
cursorTX = new PageCursorTX();
tx.putProperty(TransactionPropertyIndexes.PAGE_CURSOR_POSITIONS, cursorTX);
tx.addOperation(cursorTX);
}
cursorTX.addPositionConfirmation(this, position);
}
private PageTransactionInfo getPageTransaction(final PagedReference reference)
{
if (reference.getPagedMessage().getTransactionID() >= 0)
{
return pageStore.getPagingManager().getTransaction(reference.getPagedMessage().getTransactionID());
}
else
{
return null;
}
}
/**
* A callback from the PageCursorInfo. It will be called when all the messages on a page have been acked
* @param info
*/
private void onPageDone(final PageCursorInfo info)
{
if (autoCleanup)
{
scheduleCleanupCheck();
}
}
// Inner classes -------------------------------------------------
/**
* This will hold information about the pending ACKs towards a page.
* This instance will be released as soon as the entire page is consumed, releasing the memory at that point
* The ref counts are increased also when a message is ignored for any reason.
* */
private class PageCursorInfo
{
// Number of messages existent on this page
private final int numberOfMessages;
private final long pageId;
// TODO: Merge removedReferences and acks into a single structure
// Confirmed ACKs on this page
private final Set<PagePosition> acks = Collections.synchronizedSet(new LinkedHashSet<PagePosition>());
private WeakReference<PageCache> cache;
private Set<PagePosition> removedReferences = new ConcurrentHashSet<PagePosition>();
// The page was live at the time of the creation
private final boolean wasLive;
// There's a pending TX to add elements on this page
private AtomicInteger pendingTX = new AtomicInteger(0);
// There's a pending delete on the async IO pipe
// We're holding this object to avoid delete the pages before the IO is complete,
// however we can't delete these records again
private boolean pendingDelete;
// We need a separate counter as the cursor may be ignoring certain values because of incomplete transactions or
// expressions
private final AtomicInteger confirmed = new AtomicInteger(0);
@Override
public String toString()
{
return "PageCursorInfo::PageID=" + pageId +
" numberOfMessage = " +
numberOfMessages +
", confirmed = " +
confirmed;
}
public PageCursorInfo(final long pageId, final int numberOfMessages, final PageCache cache)
{
this.pageId = pageId;
this.numberOfMessages = numberOfMessages;
wasLive = cache.isLive();
if (wasLive)
{
this.cache = new WeakReference<PageCache>(cache);
}
}
public boolean isDone()
{
return getNumberOfMessages() == confirmed.get() && pendingTX.get() == 0;
}
public boolean isPendingDelete()
{
return pendingDelete;
}
public void setPendingDelete()
{
pendingDelete = true;
}
/**
* @return the pageId
*/
public long getPageId()
{
return pageId;
}
public void incrementPendingTX()
{
pendingTX.incrementAndGet();
}
public void decrementPendingTX()
{
pendingTX.decrementAndGet();
checkDone();
}
public boolean isRemoved(final PagePosition pos)
{
return removedReferences.contains(pos);
}
public void remove(final PagePosition position)
{
removedReferences.add(position);
}
public void addACK(final PagePosition posACK)
{
if (isTrace)
{
PageSubscriptionImpl.trace("numberOfMessages = " + getNumberOfMessages() +
" confirmed = " +
(confirmed.get() + 1) +
" pendingTX = " + pendingTX +
", page = " +
pageId + " posACK = " + posACK);
}
removedReferences.add(posACK);
boolean added = acks.add(posACK);
// Negative could mean a bookmark on the first element for the page (example -1)
if (added && posACK.getMessageNr() >= 0)
{
confirmed.incrementAndGet();
checkDone();
}
}
/**
*
*/
protected void checkDone()
{
if (isDone())
{
onPageDone(this);
}
}
private int getNumberOfMessages()
{
if (wasLive)
{
PageCache cache = this.cache.get();
if (cache != null)
{
return cache.getNumberOfMessages();
}
else
{
cache = cursorProvider.getPageCache(new PagePositionImpl(pageId, 0));
this.cache = new WeakReference<PageCache>(cache);
return cache.getNumberOfMessages();
}
}
else
{
return numberOfMessages;
}
}
}
static class PageCursorTX extends TransactionOperationAbstract
{
HashMap<PageSubscriptionImpl, List<PagePosition>> pendingPositions = new HashMap<PageSubscriptionImpl, List<PagePosition>>();
public void addPositionConfirmation(final PageSubscriptionImpl cursor, final PagePosition position)
{
List<PagePosition> list = pendingPositions.get(cursor);
if (list == null)
{
list = new LinkedList<PagePosition>();
pendingPositions.put(cursor, list);
}
list.add(position);
}
/* (non-Javadoc)
* @see org.hornetq.core.transaction.TransactionOperation#afterCommit(org.hornetq.core.transaction.Transaction)
*/
@Override
public void afterCommit(final Transaction tx)
{
for (Entry<PageSubscriptionImpl, List<PagePosition>> entry : pendingPositions.entrySet())
{
PageSubscriptionImpl cursor = entry.getKey();
List<PagePosition> positions = entry.getValue();
for (PagePosition confirmed : positions)
{
cursor.processACK(confirmed);
cursor.deliveredCount.decrementAndGet();
}
}
}
/* (non-Javadoc)
* @see org.hornetq.core.transaction.TransactionOperation#getRelatedMessageReferences()
*/
public List<MessageReference> getRelatedMessageReferences()
{
return Collections.emptyList();
}
}
class CursorIterator implements LinkedListIterator<PagedReference>
{
private PagePosition position = null;
private PagePosition lastOperation = null;
private volatile boolean isredelivery = false;
private volatile PagedReference lastRedelivery = null;
/** next element taken on hasNext test.
* it has to be delivered on next next operation */
private volatile PagedReference cachedNext;
public CursorIterator()
{
}
public void repeat()
{
if (isredelivery)
{
synchronized (redeliveries)
{
cachedNext = lastRedelivery;
}
}
else
{
if (lastOperation == null)
{
position = null;
}
else
{
position = lastOperation;
}
}
}
/* (non-Javadoc)
* @see java.util.Iterator#next()
*/
public synchronized PagedReference next()
{
if (cachedNext != null)
{
PagedReference retPos = cachedNext;
cachedNext = null;
return retPos;
}
try
{
if (position == null)
{
position = getStartPosition();
}
return moveNext();
}
catch (Exception e)
{
throw new RuntimeException(e.getMessage(), e);
}
}
/* (non-Javadoc)
* @see org.hornetq.core.paging.cursor.PageCursor#moveNext()
*/
public PagedReference moveNext() throws Exception
{
synchronized (PageSubscriptionImpl.this)
{
boolean match = false;
PagedReference message = null;
PagePosition lastPosition = position;
PagePosition tmpPosition = position;
do
{
synchronized (redeliveries)
{
PagePosition redelivery = redeliveries.poll();
if (redelivery != null)
{
// There's a redelivery pending, we will get it out of that pool instead
isredelivery = true;
PagedReference redeliveredMsg = getReference(redelivery);
lastRedelivery = redeliveredMsg;
return redeliveredMsg;
}
else
{
lastRedelivery = null;
isredelivery = false;
}
message = internalGetNext(tmpPosition);
}
if (message == null)
{
break;
}
tmpPosition = message.getPosition();
boolean valid = true;
boolean ignored = false;
// Validate the scenarios where the message should be considered not valid even to be considered
// 1st... is it routed?
valid = routed(message.getPagedMessage());
if (!valid)
{
ignored = true;
}
PageCursorInfo info = getPageInfo(message.getPosition(), false);
if (info != null && info.isRemoved(message.getPosition()))
{
continue;
}
// 2nd ... if TX, is it committed?
if (valid && message.getPagedMessage().getTransactionID() >= 0)
{
PageTransactionInfo tx = pageStore.getPagingManager().getTransaction(message.getPagedMessage()
.getTransactionID());
if (tx == null)
{
log.warn("Couldn't locate page transaction " + message.getPagedMessage().getTransactionID() +
", ignoring message on position " +
message.getPosition() + " on address=" + pageStore.getAddress() + " queue=" + queue.getName());
valid = false;
ignored = true;
}
else
{
if (tx.deliverAfterCommit(PageSubscriptionImpl.this, message.getPosition()))
{
valid = false;
ignored = false;
}
}
}
// 3rd... was it previously removed?
if (valid)
{
// We don't create a PageCursorInfo unless we are doing a write operation (ack or removing)
// Say you have a Browser that will only read the files... there's no need to control PageCursors is
// nothing
// is being changed. That's why the false is passed as a parameter here
if (info != null && info.isRemoved(message.getPosition()))
{
valid = false;
}
}
if (!ignored)
{
position = message.getPosition();
}
if (valid)
{
match = match(message.getMessage());
if (!match)
{
processACK(message.getPosition());
}
}
else if (ignored)
{
positionIgnored(message.getPosition());
}
}
while (message != null && !match);
if (message != null)
{
lastOperation = lastPosition;
}
return message;
}
}
/** QueueImpl::deliver could be calling hasNext while QueueImpl.depage could be using next and hasNext as well.
* It would be a rare race condition but I would prefer avoiding that scenario */
public synchronized boolean hasNext()
{
// if an unbehaved program called hasNext twice before next, we only cache it once.
if (cachedNext != null)
{
return true;
}
if (!pageStore.isPaging())
{
return false;
}
cachedNext = next();
return cachedNext != null;
}
/* (non-Javadoc)
* @see java.util.Iterator#remove()
*/
public void remove()
{
deliveredCount.incrementAndGet();
PageSubscriptionImpl.this.getPageInfo(position).remove(position);
}
/* (non-Javadoc)
* @see org.hornetq.utils.LinkedListIterator#close()
*/
public void close()
{
}
}
}