/**
* Licensed to the Apache Software Foundation (ASF) under one
* or more contributor license agreements. See the NOTICE file
* distributed with this work for additional information
* regarding copyright ownership. The ASF licenses this file
* to you under the Apache License, Version 2.0 (the
* "License"); you may not use this file except in compliance
* with the License. You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
* See the License for the specific language governing permissions and
* limitations under the License.
*/
package org.apache.zookeeper.server;
import java.io.ByteArrayOutputStream;
import java.io.File;
import java.io.IOException;
import java.nio.ByteBuffer;
import java.util.ArrayList;
import java.util.Arrays;
import java.util.HashMap;
import java.util.LinkedList;
import java.util.List;
import java.util.Random;
import java.util.concurrent.ConcurrentHashMap;
import java.util.concurrent.LinkedBlockingQueue;
import org.apache.jute.BinaryInputArchive;
import org.apache.jute.BinaryOutputArchive;
import org.apache.jute.InputArchive;
import org.apache.jute.OutputArchive;
import org.apache.jute.Record;
import org.apache.log4j.Logger;
import org.apache.zookeeper.Environment;
import org.apache.zookeeper.KeeperException.SessionExpiredException;
import org.apache.zookeeper.ZooDefs.OpCode;
import org.apache.zookeeper.data.ACL;
import org.apache.zookeeper.data.Id;
import org.apache.zookeeper.data.StatPersisted;
import org.apache.zookeeper.jmx.MBeanRegistry;
import org.apache.zookeeper.proto.RequestHeader;
import org.apache.zookeeper.server.SessionTracker.SessionExpirer;
import org.apache.zookeeper.server.persistence.FileTxnSnapLog;
import org.apache.zookeeper.server.persistence.FileTxnSnapLog.PlayBackListener;
import org.apache.zookeeper.server.quorum.Leader;
import org.apache.zookeeper.server.quorum.QuorumPacket;
import org.apache.zookeeper.server.quorum.Leader.Proposal;
import org.apache.zookeeper.server.util.SerializeUtils;
import org.apache.zookeeper.txn.TxnHeader;
/**
* This class implements a simple standalone ZooKeeperServer. It sets up the
* following chain of RequestProcessors to process requests:
* PrepRequestProcessor -> SyncRequestProcessor -> FinalRequestProcessor
*/
public class ZooKeeperServer implements SessionExpirer, ServerStats.Provider {
protected static final Logger LOG;
static {
LOG = Logger.getLogger(ZooKeeperServer.class);
Environment.logEnv("Server environment:", LOG);
}
protected ZooKeeperServerBean jmxServerBean;
protected DataTreeBean jmxDataTreeBean;
/**
* Create an instance of ZooKeeper server
*/
static public interface Factory {
public ZooKeeperServer createServer() throws IOException;
public NIOServerCnxn.Factory createConnectionFactory()
throws IOException;
}
/**
* The server delegates loading of the tree to an instance of the interface
*/
public interface DataTreeBuilder {
public DataTree build();
}
static public class BasicDataTreeBuilder implements DataTreeBuilder {
public DataTree build() {
return new DataTree();
}
}
public static final int DEFAULT_TICK_TIME = 3000;
protected int tickTime = DEFAULT_TICK_TIME;
public static final int commitLogCount = 500;
public int commitLogBuffer = 700;
public LinkedList<Proposal> committedLog = new LinkedList<Proposal>();
public long minCommittedLog, maxCommittedLog;
private DataTreeBuilder treeBuilder;
public DataTree dataTree;
protected SessionTracker sessionTracker;
private FileTxnSnapLog txnLogFactory = null;
protected ConcurrentHashMap<Long, Integer> sessionsWithTimeouts;
protected long hzxid = 0;
final public static Exception ok = new Exception("No prob");
protected RequestProcessor firstProcessor;
protected volatile boolean running;
/**
* This is the secret that we use to generate passwords, for the moment it
* is more of a sanity check.
*/
static final private long superSecret = 0XB3415C00L;
int requestsInProcess;
List<ChangeRecord> outstandingChanges = new ArrayList<ChangeRecord>();
// this data structure must be accessed under the outstandingChanges lock
HashMap<String, ChangeRecord> outstandingChangesForPath = new HashMap<String, ChangeRecord>();
private NIOServerCnxn.Factory serverCnxnFactory;
private final ServerStats serverStats;
void removeCnxn(ServerCnxn cnxn) {
dataTree.removeCnxn(cnxn);
}
/**
* Creates a ZooKeeperServer instance. Nothing is setup, use the setX
* methods to prepare the instance (eg datadir, datalogdir, ticktime,
* builder, etc...)
*
* @throws IOException
*/
public ZooKeeperServer() {
serverStats = new ServerStats(this);
treeBuilder = new BasicDataTreeBuilder();
}
/**
* Creates a ZooKeeperServer instance. It sets everything up, but doesn't
* actually start listening for clients until run() is invoked.
*
* @param dataDir the directory to put the data
* @throws IOException
*/
public ZooKeeperServer(FileTxnSnapLog txnLogFactory, int tickTime,
DataTreeBuilder treeBuilder) throws IOException {
serverStats = new ServerStats(this);
this.treeBuilder = treeBuilder;
this.txnLogFactory = txnLogFactory;
this.tickTime = tickTime;
LOG.info("Created server");
}
public ServerStats serverStats() {
return serverStats;
}
/**
* This constructor is for backward compatibility with the existing unit
* test code.
* It defaults to FileLogProvider persistence provider.
*/
public ZooKeeperServer(File snapDir, File logDir, int tickTime)
throws IOException {
this(new FileTxnSnapLog(snapDir,logDir),
tickTime,new BasicDataTreeBuilder());
}
/**
* Default constructor, relies on the config for its agrument values
*
* @throws IOException
*/
public ZooKeeperServer(FileTxnSnapLog txnLogFactory,DataTreeBuilder treeBuilder) throws IOException {
this(txnLogFactory, DEFAULT_TICK_TIME, treeBuilder);
}
/**
* Restore sessions and data
*/
public void loadData() throws IOException, InterruptedException {
PlayBackListener listener=new PlayBackListener(){
public void onTxnLoaded(TxnHeader hdr,Record txn){
Request r = new Request(null, 0, hdr.getCxid(),hdr.getType(),
null, null);
r.txn = txn;
r.hdr = hdr;
r.zxid = hdr.getZxid();
addCommittedProposal(r);
}
};
sessionsWithTimeouts = new ConcurrentHashMap<Long, Integer>();
dataTree = treeBuilder.build();
setZxid(txnLogFactory.restore(dataTree,sessionsWithTimeouts,listener));
// Clean up dead sessions
LinkedList<Long> deadSessions = new LinkedList<Long>();
for (long session : dataTree.getSessions()) {
if (sessionsWithTimeouts.get(session) == null) {
deadSessions.add(session);
}
}
dataTree.initialized = true;
for (long session : deadSessions) {
// XXX: Is lastProcessedZxid really the best thing to use?
killSession(session, dataTree.lastProcessedZxid);
}
// Make a clean snapshot
takeSnapshot();
}
/**
* maintains a list of last 500 or so committed requests. This is used for
* fast follower synchronization.
*
* @param request committed request
*/
public void addCommittedProposal(Request request) {
synchronized (committedLog) {
if (committedLog.size() > commitLogCount) {
committedLog.removeFirst();
minCommittedLog = committedLog.getFirst().packet.getZxid();
}
if (committedLog.size() == 0) {
minCommittedLog = request.zxid;
maxCommittedLog = request.zxid;
}
ByteArrayOutputStream baos = new ByteArrayOutputStream();
BinaryOutputArchive boa = BinaryOutputArchive.getArchive(baos);
try {
request.hdr.serialize(boa, "hdr");
if (request.txn != null) {
request.txn.serialize(boa, "txn");
}
baos.close();
} catch (IOException e) {
LOG.error("This really should be impossible", e);
}
QuorumPacket pp = new QuorumPacket(Leader.PROPOSAL, request.zxid,
baos.toByteArray(), null);
Proposal p = new Proposal();
p.packet = pp;
p.request = request;
committedLog.add(p);
maxCommittedLog = p.packet.getZxid();
}
}
public void takeSnapshot(){
try {
txnLogFactory.save(dataTree, sessionsWithTimeouts);
} catch (IOException e) {
LOG.fatal("Severe unrecoverable error, exiting", e);
// This is a severe error that we cannot recover from,
// so we need to exit
System.exit(10);
}
}
public void serializeSnapshot(OutputArchive oa) throws IOException,
InterruptedException {
SerializeUtils.serializeSnapshot(dataTree, oa, sessionsWithTimeouts);
}
public void deserializeSnapshot(InputArchive ia) throws IOException {
sessionsWithTimeouts = new ConcurrentHashMap<Long, Integer>();
dataTree = treeBuilder.build();
SerializeUtils.deserializeSnapshot(dataTree,ia,sessionsWithTimeouts);
}
/**
* This should be called from a synchronized block on this!
*/
synchronized public long getZxid() {
return hzxid;
}
synchronized long getNextZxid() {
return ++hzxid;
}
synchronized public void setZxid(long zxid) {
hzxid = zxid;
}
long getTime() {
return System.currentTimeMillis();
}
private void close(long sessionId) {
submitRequest(null, sessionId, OpCode.closeSession, 0, null, null);
}
public void closeSession(long sessionId) {
LOG.info("Closing session 0x" + Long.toHexString(sessionId));
// we do not want to wait for a session close. send it as soon as we
// detect it!
close(sessionId);
}
protected void killSession(long sessionId, long zxid) {
dataTree.killSession(sessionId, zxid);
if (LOG.isTraceEnabled()) {
ZooTrace.logTraceMessage(LOG, ZooTrace.SESSION_TRACE_MASK,
"ZooKeeperServer --- killSession: 0x"
+ Long.toHexString(sessionId));
}
if (sessionTracker != null) {
sessionTracker.removeSession(sessionId);
}
}
public void expire(long sessionId) {
LOG.info("Expiring session 0x" + Long.toHexString(sessionId));
close(sessionId);
}
void touch(ServerCnxn cnxn) throws IOException {
if (cnxn == null) {
return;
}
long id = cnxn.getSessionId();
int to = cnxn.getSessionTimeout();
if (!sessionTracker.touchSession(id, to)) {
throw new IOException("Missing session 0x" + Long.toHexString(id));
}
}
protected void registerJMX() {
// register with JMX
try {
jmxServerBean = new ZooKeeperServerBean(this);
MBeanRegistry.getInstance().register(jmxServerBean, null);
try {
jmxDataTreeBean = new DataTreeBean(dataTree);
MBeanRegistry.getInstance().register(jmxDataTreeBean, jmxServerBean);
} catch (Exception e) {
LOG.warn("Failed to register with JMX", e);
jmxDataTreeBean = null;
}
} catch (Exception e) {
LOG.warn("Failed to register with JMX", e);
jmxServerBean = null;
}
}
public void startup() throws IOException, InterruptedException {
if (dataTree == null) {
loadData();
}
createSessionTracker();
setupRequestProcessors();
registerJMX();
synchronized (this) {
running = true;
notifyAll();
}
}
protected void setupRequestProcessors() {
RequestProcessor finalProcessor = new FinalRequestProcessor(this);
RequestProcessor syncProcessor = new SyncRequestProcessor(this,
finalProcessor);
((SyncRequestProcessor)syncProcessor).start();
firstProcessor = new PrepRequestProcessor(this, syncProcessor);
((PrepRequestProcessor)firstProcessor).start();
}
protected void createSessionTracker() {
sessionTracker = new SessionTrackerImpl(this, sessionsWithTimeouts,
tickTime, 1);
((SessionTrackerImpl)sessionTracker).start();
}
public boolean isRunning() {
return running;
}
public void shutdown() {
// new RuntimeException("Calling shutdown").printStackTrace();
this.running = false;
// Since sessionTracker and syncThreads poll we just have to
// set running to false and they will detect it during the poll
// interval.
if (sessionTracker != null) {
sessionTracker.shutdown();
}
if (firstProcessor != null) {
firstProcessor.shutdown();
}
if (dataTree != null) {
dataTree.clear();
}
unregisterJMX();
}
protected void unregisterJMX() {
// unregister from JMX
try {
if (jmxDataTreeBean != null) {
MBeanRegistry.getInstance().unregister(jmxDataTreeBean);
}
} catch (Exception e) {
LOG.warn("Failed to unregister with JMX", e);
}
try {
if (jmxServerBean != null) {
MBeanRegistry.getInstance().unregister(jmxServerBean);
}
} catch (Exception e) {
LOG.warn("Failed to unregister with JMX", e);
}
jmxServerBean = null;
jmxDataTreeBean = null;
}
synchronized public void incInProcess() {
requestsInProcess++;
}
synchronized public void decInProcess() {
requestsInProcess--;
}
public int getInProcess() {
return requestsInProcess;
}
/**
* This structure is used to facilitate information sharing between PrepRP
* and FinalRP.
*/
static class ChangeRecord {
ChangeRecord(long zxid, String path, StatPersisted stat, int childCount,
List<ACL> acl) {
this.zxid = zxid;
this.path = path;
this.stat = stat;
this.childCount = childCount;
this.acl = acl;
}
long zxid;
String path;
StatPersisted stat; /* Make sure to create a new object when changing */
int childCount;
List<ACL> acl; /* Make sure to create a new object when changing */
@SuppressWarnings("unchecked")
ChangeRecord duplicate(long zxid) {
StatPersisted stat = new StatPersisted();
if (this.stat != null) {
DataTree.copyStatPersisted(this.stat, stat);
}
return new ChangeRecord(zxid, path, stat, childCount,
acl == null ? new ArrayList<ACL>() : new ArrayList(acl));
}
}
byte[] generatePasswd(long id) {
Random r = new Random(id ^ superSecret);
byte p[] = new byte[16];
r.nextBytes(p);
return p;
}
protected boolean checkPasswd(long sessionId, byte[] passwd) {
return sessionId != 0
&& Arrays.equals(passwd, generatePasswd(sessionId));
}
long createSession(ServerCnxn cnxn, byte passwd[], int timeout)
throws InterruptedException {
long sessionId = sessionTracker.createSession(timeout);
Random r = new Random(sessionId ^ superSecret);
r.nextBytes(passwd);
ByteBuffer to = ByteBuffer.allocate(4);
to.putInt(timeout);
cnxn.setSessionId(sessionId);
submitRequest(cnxn, sessionId, OpCode.createSession, 0, to, null);
return sessionId;
}
/**
* set the owner of this session as owner
* @param id the session id
* @param owner the owner of the session
* @throws SessionExpiredException
*/
public void setOwner(long id, Object owner) throws SessionExpiredException {
sessionTracker.setOwner(id, owner);
}
protected void revalidateSession(ServerCnxn cnxn, long sessionId,
int sessionTimeout) throws IOException, InterruptedException {
boolean rc = sessionTracker.touchSession(sessionId, sessionTimeout);
if (LOG.isTraceEnabled()) {
ZooTrace.logTraceMessage(LOG,ZooTrace.SESSION_TRACE_MASK,
"Session 0x" + Long.toHexString(sessionId) +
" is valid: " + rc);
}
cnxn.finishSessionInit(rc);
}
public void reopenSession(ServerCnxn cnxn, long sessionId, byte[] passwd,
int sessionTimeout) throws IOException, InterruptedException {
if (!checkPasswd(sessionId, passwd)) {
cnxn.finishSessionInit(false);
} else {
revalidateSession(cnxn, sessionId, sessionTimeout);
}
}
public void closeSession(ServerCnxn cnxn, RequestHeader requestHeader) {
closeSession(cnxn.getSessionId());
}
public long getServerId() {
return 0;
}
/**
* @param cnxn
* @param sessionId
* @param xid
* @param bb
*/
private void submitRequest(ServerCnxn cnxn, long sessionId, int type,
int xid, ByteBuffer bb, List<Id> authInfo) {
Request si = new Request(cnxn, sessionId, xid, type, bb, authInfo);
submitRequest(si);
}
public void submitRequest(Request si) {
if (firstProcessor == null) {
synchronized (this) {
try {
while (!running) {
wait(1000);
}
} catch (InterruptedException e) {
LOG.warn("Unexpected interruption", e);
}
if (firstProcessor == null) {
throw new RuntimeException("Not started");
}
}
}
try {
touch(si.cnxn);
boolean validpacket = Request.isValid(si.type);
if (validpacket) {
firstProcessor.processRequest(si);
if (si.cnxn != null) {
incInProcess();
}
} else {
LOG.warn("Dropping packet at server of type " + si.type);
// if invalid packet drop the packet.
}
} catch (IOException e) {
LOG.warn("Ignoring unexpected exception", e);
}
}
static public void byteBuffer2Record(ByteBuffer bb, Record record)
throws IOException {
BinaryInputArchive ia;
ia = BinaryInputArchive.getArchive(new ByteBufferInputStream(bb));
record.deserialize(ia, "request");
}
public static int getSnapCount() {
String sc = System.getProperty("zookeeper.snapCount");
try {
return Integer.parseInt(sc);
} catch (Exception e) {
return 100000;
}
}
public int getGlobalOutstandingLimit() {
String sc = System.getProperty("zookeeper.globalOutstandingLimit");
int limit;
try {
limit = Integer.parseInt(sc);
} catch (Exception e) {
limit = 1000;
}
return limit;
}
public void setServerCnxnFactory(NIOServerCnxn.Factory factory) {
serverCnxnFactory = factory;
}
public NIOServerCnxn.Factory getServerCnxnFactory() {
return serverCnxnFactory;
}
/**
* return the last proceesed id from the
* datatree
*/
public long getLastProcessedZxid() {
return dataTree.lastProcessedZxid;
}
/**
* return the outstanding requests
* in the queue, which havent been
* processed yet
*/
public long getOutstandingRequests() {
return getInProcess();
}
/**
* trunccate the log to get in sync with others
* if in a quorum
* @param zxid the zxid that it needs to get in sync
* with others
* @throws IOException
*/
public void truncateLog(long zxid) throws IOException {
this.txnLogFactory.truncateLog(zxid);
}
/**
* the snapshot and logwriter for this instance
* @return
*/
public FileTxnSnapLog getLogWriter() {
return this.txnLogFactory;
}
public int getTickTime() {
return tickTime;
}
public void setTickTime(int tickTime) {
this.tickTime = tickTime;
}
public DataTreeBuilder getTreeBuilder() {
return treeBuilder;
}
public void setTreeBuilder(DataTreeBuilder treeBuilder) {
this.treeBuilder = treeBuilder;
}
public int getClientPort() {
return serverCnxnFactory != null ? serverCnxnFactory.ss.socket().getLocalPort() : -1;
}
public void setTxnLogFactory(FileTxnSnapLog txnLog) {
this.txnLogFactory = txnLog;
}
public FileTxnSnapLog getTxnLogFactory() {
return this.txnLogFactory;
}
public String getState() {
return "standalone";
}
}